C13H19NO — CID 165361906
N-methyl-N-[1-(4-methylphenyl)propan-2-yl]acetamide (PubChem CID 165361906) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is N-methyl-N-[1-(4-methylphenyl)propan-2-yl]acetamide.
| Compound Name | N-methyl-N-[1-(4-methylphenyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 165361906 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | N-methyl-N-[1-(4-methylphenyl)propan-2-yl]acetamide |
| SMILES | CC(=O)N(C)C(C)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C13H19NO/c1-10-5-7-13(8-6-10)9-11(2)14(4)12(3)15/h5-8,11H,9H2,1-4H3 |
| InChIKey | KHVGPNAPQHMDCK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |