C16H27ClN2O — CID 119330280
2-amino-N-methyl-N-[1-(4-methylphenyl)propan-2-yl]pentanamide;hydrochloride (PubChem CID 119330280) has the molecular formula C16H27ClN2O and a molecular weight of 298.86 g/mol. Its IUPAC name is 2-amino-N-methyl-N-[1-(4-methylphenyl)propan-2-yl]pentanamide;hydrochloride.
| Compound Name | 2-amino-N-methyl-N-[1-(4-methylphenyl)propan-2-yl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119330280 |
| Molecular Formula | C16H27ClN2O |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 2-amino-N-methyl-N-[1-(4-methylphenyl)propan-2-yl]pentanamide;hydrochloride |
| SMILES | CCCC(N)C(=O)N(C)C(C)Cc1ccc(C)cc1.Cl |
| InChI | InChI=1S/C16H26N2O.ClH/c1-5-6-15(17)16(19)18(4)13(3)11-14-9-7-12(2)8-10-14;/h7-10,13,15H,5-6,11,17H2,1-4H3;1H |
| InChIKey | OSDCZUNPWGCUTJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |