C18H21ClN2O3 — CID 111453246
1-(3-chloro-2-methoxyphenyl)-3-(4-hydroxy-2-phenylbutyl)urea (PubChem CID 111453246) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is 1-(3-chloro-2-methoxyphenyl)-3-(4-hydroxy-2-phenylbutyl)urea.
| Compound Name | 1-(3-chloro-2-methoxyphenyl)-3-(4-hydroxy-2-phenylbutyl)urea |
|---|---|
| PubChem CID | 111453246 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 1-(3-chloro-2-methoxyphenyl)-3-(4-hydroxy-2-phenylbutyl)urea |
| SMILES | COc1c(Cl)cccc1NC(=O)NCC(CCO)c1ccccc1 |
| InChI | InChI=1S/C18H21ClN2O3/c1-24-17-15(19)8-5-9-16(17)21-18(23)20-12-14(10-11-22)13-6-3-2-4-7-13/h2-9,14,22H,10-12H2,1H3,(H2,20,21,23) |
| InChIKey | DKKXVXWBBJQBKF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |