C21H26N2O2 — CID 111450476
1-(2,3-dihydro-1H-inden-5-ylmethyl)-3-(4-hydroxy-2-phenylbutyl)urea (PubChem CID 111450476) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-ylmethyl)-3-(4-hydroxy-2-phenylbutyl)urea.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-ylmethyl)-3-(4-hydroxy-2-phenylbutyl)urea |
|---|---|
| PubChem CID | 111450476 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-ylmethyl)-3-(4-hydroxy-2-phenylbutyl)urea |
| SMILES | O=C(NCc1ccc2c(c1)CCC2)NCC(CCO)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O2/c24-12-11-20(17-5-2-1-3-6-17)15-23-21(25)22-14-16-9-10-18-7-4-8-19(18)13-16/h1-3,5-6,9-10,13,20,24H,4,7-8,11-12,14-15H2,(H2,22,23,25) |
| InChIKey | XDEWVDMPXCFUJA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |