C14H22N2O4 — CID 107566688
(2R)-2-[1-(2,5-dimethylfuran-3-yl)ethylcarbamoylamino]pentanoic acid (PubChem CID 107566688) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is (2R)-2-[1-(2,5-dimethylfuran-3-yl)ethylcarbamoylamino]pentanoic acid.
| Compound Name | (2R)-2-[1-(2,5-dimethylfuran-3-yl)ethylcarbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 107566688 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (2R)-2-[1-(2,5-dimethylfuran-3-yl)ethylcarbamoylamino]pentanoic acid |
| SMILES | CCC[C@@H](NC(=O)NC(C)c1cc(C)oc1C)C(=O)O |
| InChI | InChI=1S/C14H22N2O4/c1-5-6-12(13(17)18)16-14(19)15-9(3)11-7-8(2)20-10(11)4/h7,9,12H,5-6H2,1-4H3,(H,17,18)(H2,15,16,19)/t9?,12-/m1/s1 |
| InChIKey | NRXCFJGRMOQWQU-FFFFSGIJSA-N |
| XLogP | 2.51 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |