C13H16Cl2N2O4 — CID 106109635
3-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]-2-methoxypropanoic acid (PubChem CID 106109635) has the molecular formula C13H16Cl2N2O4 and a molecular weight of 335.19 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]-2-methoxypropanoic acid.
| Compound Name | 3-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 106109635 |
| Molecular Formula | C13H16Cl2N2O4 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 3-[2-(2,4-dichlorophenyl)ethylcarbamoylamino]-2-methoxypropanoic acid |
| SMILES | COC(CNC(=O)NCCc1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C13H16Cl2N2O4/c1-21-11(12(18)19)7-17-13(20)16-5-4-8-2-3-9(14)6-10(8)15/h2-3,6,11H,4-5,7H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | ATLIUYJLUDIPJT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |