C16H18F2O2 — CID 144811646
2,2-difluoro-4-naphthalen-2-ylbutanoic acid;ethane (PubChem CID 144811646) has the molecular formula C16H18F2O2 and a molecular weight of 280.31 g/mol. Its IUPAC name is 2,2-difluoro-4-naphthalen-2-ylbutanoic acid;ethane.
| Compound Name | 2,2-difluoro-4-naphthalen-2-ylbutanoic acid;ethane |
|---|---|
| PubChem CID | 144811646 |
| Molecular Formula | C16H18F2O2 |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2,2-difluoro-4-naphthalen-2-ylbutanoic acid;ethane |
| SMILES | CC.O=C(O)C(F)(F)CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H12F2O2.C2H6/c15-14(16,13(17)18)8-7-10-5-6-11-3-1-2-4-12(11)9-10;1-2/h1-6,9H,7-8H2,(H,17,18);1-2H3 |
| InChIKey | WHKWKWPBPWOFCI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |