C13H18BrNO3 — CID 115178909
N-[2-(3-bromo-4-methoxyphenyl)ethyl]-2-hydroxy-2-methylpropanamide (PubChem CID 115178909) has the molecular formula C13H18BrNO3 and a molecular weight of 316.20 g/mol. Its IUPAC name is N-[2-(3-bromo-4-methoxyphenyl)ethyl]-2-hydroxy-2-methylpropanamide.
| Compound Name | N-[2-(3-bromo-4-methoxyphenyl)ethyl]-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 115178909 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | N-[2-(3-bromo-4-methoxyphenyl)ethyl]-2-hydroxy-2-methylpropanamide |
| SMILES | COc1ccc(CCNC(=O)C(C)(C)O)cc1Br |
| InChI | InChI=1S/C13H18BrNO3/c1-13(2,17)12(16)15-7-6-9-4-5-11(18-3)10(14)8-9/h4-5,8,17H,6-7H2,1-3H3,(H,15,16) |
| InChIKey | OGSOSUQPUCLOLD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |