C14H21BrN2O2 — CID 115155049
3-amino-N-[2-(3-bromo-4-methoxyphenyl)ethyl]-3-methylbutanamide (PubChem CID 115155049) has the molecular formula C14H21BrN2O2 and a molecular weight of 329.24 g/mol. Its IUPAC name is 3-amino-N-[2-(3-bromo-4-methoxyphenyl)ethyl]-3-methylbutanamide.
| Compound Name | 3-amino-N-[2-(3-bromo-4-methoxyphenyl)ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 115155049 |
| Molecular Formula | C14H21BrN2O2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 3-amino-N-[2-(3-bromo-4-methoxyphenyl)ethyl]-3-methylbutanamide |
| SMILES | COc1ccc(CCNC(=O)CC(C)(C)N)cc1Br |
| InChI | InChI=1S/C14H21BrN2O2/c1-14(2,16)9-13(18)17-7-6-10-4-5-12(19-3)11(15)8-10/h4-5,8H,6-7,9,16H2,1-3H3,(H,17,18) |
| InChIKey | DRURUCRXDKAANT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |