C14H18BrNO5 — CID 107834076
(2S)-4-[3-(3-bromo-4-methoxyphenyl)propanoylamino]-2-hydroxybutanoic acid (PubChem CID 107834076) has the molecular formula C14H18BrNO5 and a molecular weight of 360.20 g/mol. Its IUPAC name is (2S)-4-[3-(3-bromo-4-methoxyphenyl)propanoylamino]-2-hydroxybutanoic acid.
| Compound Name | (2S)-4-[3-(3-bromo-4-methoxyphenyl)propanoylamino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107834076 |
| Molecular Formula | C14H18BrNO5 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | (2S)-4-[3-(3-bromo-4-methoxyphenyl)propanoylamino]-2-hydroxybutanoic acid |
| SMILES | COc1ccc(CCC(=O)NCC[C@H](O)C(=O)O)cc1Br |
| InChI | InChI=1S/C14H18BrNO5/c1-21-12-4-2-9(8-10(12)15)3-5-13(18)16-7-6-11(17)14(19)20/h2,4,8,11,17H,3,5-7H2,1H3,(H,16,18)(H,19,20)/t11-/m0/s1 |
| InChIKey | IPIXLCXYYHYRTQ-NSHDSACASA-N |
| XLogP | 1.34 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |