C13H18N2O4 — CID 107836146
4-[3-(4-aminophenyl)propanoylamino]-2-hydroxybutanoic acid (PubChem CID 107836146) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-[3-(4-aminophenyl)propanoylamino]-2-hydroxybutanoic acid.
| Compound Name | 4-[3-(4-aminophenyl)propanoylamino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107836146 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 4-[3-(4-aminophenyl)propanoylamino]-2-hydroxybutanoic acid |
| SMILES | Nc1ccc(CCC(=O)NCCC(O)C(=O)O)cc1 |
| InChI | InChI=1S/C13H18N2O4/c14-10-4-1-9(2-5-10)3-6-12(17)15-8-7-11(16)13(18)19/h1-2,4-5,11,16H,3,6-8,14H2,(H,15,17)(H,18,19) |
| InChIKey | VGFGHALURUSUDG-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|