C16H22BrNO4 — CID 119188562
2-[3-(3-bromo-4-methoxyphenyl)propanoylamino]-4-methylpentanoic acid (PubChem CID 119188562) has the molecular formula C16H22BrNO4 and a molecular weight of 372.26 g/mol. Its IUPAC name is 2-[3-(3-bromo-4-methoxyphenyl)propanoylamino]-4-methylpentanoic acid.
| Compound Name | 2-[3-(3-bromo-4-methoxyphenyl)propanoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119188562 |
| Molecular Formula | C16H22BrNO4 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 2-[3-(3-bromo-4-methoxyphenyl)propanoylamino]-4-methylpentanoic acid |
| SMILES | COc1ccc(CCC(=O)NC(CC(C)C)C(=O)O)cc1Br |
| InChI | InChI=1S/C16H22BrNO4/c1-10(2)8-13(16(20)21)18-15(19)7-5-11-4-6-14(22-3)12(17)9-11/h4,6,9-10,13H,5,7-8H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | ZXQBKZPRZYGNAP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |