C15H20BrNO4 — CID 61137171
(2S)-2-[3-(3-bromo-4-methoxyphenyl)propanoylamino]-3-methylbutanoic acid (PubChem CID 61137171) has the molecular formula C15H20BrNO4 and a molecular weight of 358.23 g/mol. Its IUPAC name is (2S)-2-[3-(3-bromo-4-methoxyphenyl)propanoylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[3-(3-bromo-4-methoxyphenyl)propanoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 61137171 |
| Molecular Formula | C15H20BrNO4 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | (2S)-2-[3-(3-bromo-4-methoxyphenyl)propanoylamino]-3-methylbutanoic acid |
| SMILES | COc1ccc(CCC(=O)N[C@H](C(=O)O)C(C)C)cc1Br |
| InChI | InChI=1S/C15H20BrNO4/c1-9(2)14(15(19)20)17-13(18)7-5-10-4-6-12(21-3)11(16)8-10/h4,6,8-9,14H,5,7H2,1-3H3,(H,17,18)(H,19,20)/t14-/m0/s1 |
| InChIKey | ZRCMGZQXHZHGBD-AWEZNQCLSA-N |
| XLogP | 2.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |