C16H24BrNO3 — CID 103861986
3-(3-bromo-4-methoxyphenyl)-N-(5-hydroxy-4-methylpentyl)propanamide (PubChem CID 103861986) has the molecular formula C16H24BrNO3 and a molecular weight of 358.28 g/mol. Its IUPAC name is 3-(3-bromo-4-methoxyphenyl)-N-(5-hydroxy-4-methylpentyl)propanamide.
| Compound Name | 3-(3-bromo-4-methoxyphenyl)-N-(5-hydroxy-4-methylpentyl)propanamide |
|---|---|
| PubChem CID | 103861986 |
| Molecular Formula | C16H24BrNO3 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 3-(3-bromo-4-methoxyphenyl)-N-(5-hydroxy-4-methylpentyl)propanamide |
| SMILES | COc1ccc(CCC(=O)NCCCC(C)CO)cc1Br |
| InChI | InChI=1S/C16H24BrNO3/c1-12(11-19)4-3-9-18-16(20)8-6-13-5-7-15(21-2)14(17)10-13/h5,7,10,12,19H,3-4,6,8-9,11H2,1-2H3,(H,18,20) |
| InChIKey | IFDWFIZVRMLNGF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|