C12H14BrNO5 — CID 115144374
2-[(3-bromo-4-methoxyphenyl)methylamino]butanedioic acid (PubChem CID 115144374) has the molecular formula C12H14BrNO5 and a molecular weight of 332.15 g/mol. Its IUPAC name is 2-[(3-bromo-4-methoxyphenyl)methylamino]butanedioic acid.
| Compound Name | 2-[(3-bromo-4-methoxyphenyl)methylamino]butanedioic acid |
|---|---|
| PubChem CID | 115144374 |
| Molecular Formula | C12H14BrNO5 |
| Molecular Weight | 332.15 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 2-[(3-bromo-4-methoxyphenyl)methylamino]butanedioic acid |
| SMILES | COc1ccc(CNC(CC(=O)O)C(=O)O)cc1Br |
| InChI | InChI=1S/C12H14BrNO5/c1-19-10-3-2-7(4-8(10)13)6-14-9(12(17)18)5-11(15)16/h2-4,9,14H,5-6H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | NFMMOWAAWJJSRY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.15 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |