C15H23NO4 — CID 69227121
(3R)-3-[(3,4-dimethoxyphenyl)methylamino]-4-methylpentanoic acid (PubChem CID 69227121) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is (3R)-3-[(3,4-dimethoxyphenyl)methylamino]-4-methylpentanoic acid.
| Compound Name | (3R)-3-[(3,4-dimethoxyphenyl)methylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 69227121 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (3R)-3-[(3,4-dimethoxyphenyl)methylamino]-4-methylpentanoic acid |
| SMILES | COc1ccc(CN[C@H](CC(=O)O)C(C)C)cc1OC |
| InChI | InChI=1S/C15H23NO4/c1-10(2)12(8-15(17)18)16-9-11-5-6-13(19-3)14(7-11)20-4/h5-7,10,12,16H,8-9H2,1-4H3,(H,17,18)/t12-/m1/s1 |
| InChIKey | IVKWCZQRDAZAKA-GFCCVEGCSA-N |
| XLogP | 2.29 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |