4-(3,4-dimethoxyphenyl)-4-hydroxy-3-(methylamino)butanoic acid

C13H19NO5 — CID 82348516

IUPAC4-(3,4-dimethoxyphenyl)-4-hydroxy-3-(methylamino)butanoic acid
SMILESCNC(CC(=O)O)C(O)c1ccc(OC)c(OC)c1
InChIInChI=1S/C13H19NO5/c1-14-9(7-12(15)16)13(17)8-4-5-10(18-2)11(6-8)19-3/h4-6,9,13-14,17H,7H2,1-3H3,(H,15,16)
InChIKeyHWSXIMUNEKSUQV-UHFFFAOYSA-N
MW269.30 g/mol
LogP0.80
Rot. Bonds7

About 4-(3,4-dimethoxyphenyl)-4-hydroxy-3-(methylamino)butanoic acid

4-(3,4-dimethoxyphenyl)-4-hydroxy-3-(methylamino)butanoic acid (PubChem CID 82348516) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-4-hydroxy-3-(methylamino)butanoic acid.

Molecular Properties

Compound Name4-(3,4-dimethoxyphenyl)-4-hydroxy-3-(methylamino)butanoic acid
PubChem CID82348516
Molecular FormulaC13H19NO5
Molecular Weight269.30 g/mol
Exact Mass269.13
IUPAC Name4-(3,4-dimethoxyphenyl)-4-hydroxy-3-(methylamino)butanoic acid
SMILESCNC(CC(=O)O)C(O)c1ccc(OC)c(OC)c1
InChIInChI=1S/C13H19NO5/c1-14-9(7-12(15)16)13(17)8-4-5-10(18-2)11(6-8)19-3/h4-6,9,13-14,17H,7H2,1-3H3,(H,15,16)
InChIKeyHWSXIMUNEKSUQV-UHFFFAOYSA-N
XLogP0.80
TPSA88.02 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.30
LogP ≤ 50.80
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 4-(3,4-dimethoxyphenyl)-4-hydroxy-3-(methylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,4-dimethoxyphenyl)-4-hydroxy-3-(methylamino)butanoic acid?
The IUPAC name of 4-(3,4-dimethoxyphenyl)-4-hydroxy-3-(methylamino)butanoic acid (CID 82348516) is 4-(3,4-dimethoxyphenyl)-4-hydroxy-3-(methylamino)butanoic acid.
What is the SMILES notation for 4-(3,4-dimethoxyphenyl)-4-hydroxy-3-(methylamino)butanoic acid?
The canonical SMILES for 4-(3,4-dimethoxyphenyl)-4-hydroxy-3-(methylamino)butanoic acid is CNC(CC(=O)O)C(O)c1ccc(OC)c(OC)c1.
What is the InChIKey of 4-(3,4-dimethoxyphenyl)-4-hydroxy-3-(methylamino)butanoic acid?
The InChIKey is HWSXIMUNEKSUQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO5/c1-14-9(7-12(15)16)13(17)8-4-5-10(18-2)11(6-8)19-3/h4-6,9,13-14,17H,7H2,1-3H3,(H,15,16).
What are the key properties of 4-(3,4-dimethoxyphenyl)-4-hydroxy-3-(methylamino)butanoic acid?
4-(3,4-dimethoxyphenyl)-4-hydroxy-3-(methylamino)butanoic acid has a molecular weight of 269.30 g/mol, XLogP of 0.80, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethoxyphenyl)-4-hydroxy-3-(methylamino)butanoic acid is sourced from PubChem (CID 82348516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).