C18H18Br2N2O4 — CID 10552935
(2E)-N-[2-(3-bromo-4-hydroxyphenyl)ethyl]-3-(3-bromo-4-methoxyphenyl)-2-hydroxyiminopropanamide (PubChem CID 10552935) has the molecular formula C18H18Br2N2O4 and a molecular weight of 486.16 g/mol. Its IUPAC name is (2E)-N-[2-(3-bromo-4-hydroxyphenyl)ethyl]-3-(3-bromo-4-methoxyphenyl)-2-hydroxyiminopropanamide.
| Compound Name | (2E)-N-[2-(3-bromo-4-hydroxyphenyl)ethyl]-3-(3-bromo-4-methoxyphenyl)-2-hydroxyiminopropanamide |
|---|---|
| PubChem CID | 10552935 |
| Molecular Formula | C18H18Br2N2O4 |
| Molecular Weight | 486.16 g/mol |
| Exact Mass | 483.96 |
| IUPAC Name | (2E)-N-[2-(3-bromo-4-hydroxyphenyl)ethyl]-3-(3-bromo-4-methoxyphenyl)-2-hydroxyiminopropanamide |
| SMILES | COc1ccc(C/C(=N\O)C(=O)NCCc2ccc(O)c(Br)c2)cc1Br |
| InChI | InChI=1S/C18H18Br2N2O4/c1-26-17-5-3-12(9-14(17)20)10-15(22-25)18(24)21-7-6-11-2-4-16(23)13(19)8-11/h2-5,8-9,23,25H,6-7,10H2,1H3,(H,21,24)/b22-15+ |
| InChIKey | KOXDPWRJBODQLS-PXLXIMEGSA-N |
| XLogP | 3.66 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.16 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|