C22H24Br2N4O9S3 — CID 10581012
[2-bromo-4-[(2E)-3-[2-[2-[[(2E)-3-(3-bromo-4-hydroxyphenyl)-2-hydroxyiminopropanoyl]amino]ethyldisulfanyl]ethylamino]-2-hydroxyimino-3-oxopropyl]phenyl] hydrogen sulfate (PubChem CID 10581012) has the molecular formula C22H24Br2N4O9S3 and a molecular weight of 744.46 g/mol. Its IUPAC name is [2-bromo-4-[(2E)-3-[2-[2-[[(2E)-3-(3-bromo-4-hydroxyphenyl)-2-hydroxyiminopropanoyl]amino]ethyldisulfanyl]ethylamino]-2-hydroxyimino-3-oxopropyl]phenyl] hydrogen sulfate.
| Compound Name | [2-bromo-4-[(2E)-3-[2-[2-[[(2E)-3-(3-bromo-4-hydroxyphenyl)-2-hydroxyiminopropanoyl]amino]ethyldisulfanyl]ethylamino]-2-hydroxyimino-3-oxopropyl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 10581012 |
| Molecular Formula | C22H24Br2N4O9S3 |
| Molecular Weight | 744.46 g/mol |
| Exact Mass | 741.91 |
| IUPAC Name | [2-bromo-4-[(2E)-3-[2-[2-[[(2E)-3-(3-bromo-4-hydroxyphenyl)-2-hydroxyiminopropanoyl]amino]ethyldisulfanyl]ethylamino]-2-hydroxyimino-3-oxopropyl]phenyl] hydrogen sulfate |
| SMILES | O=C(NCCSSCCNC(=O)/C(Cc1ccc(OS(=O)(=O)O)c(Br)c1)=N/O)/C(Cc1ccc(O)c(Br)c1)=N/O |
| InChI | InChI=1S/C22H24Br2N4O9S3/c23-15-9-13(1-3-19(15)29)11-17(27-32)21(30)25-5-7-38-39-8-6-26-22(31)18(28-33)12-14-2-4-20(16(24)10-14)37-40(34,35)36/h1-4,9-10,29,32-33H,5-8,11-12H2,(H,25,30)(H,26,31)(H,34,35,36)/b27-17+,28-18+ |
| InChIKey | ZMKGRTIBYGQWSC-XUIWWLCJSA-N |
| XLogP | 3.16 |
| TPSA | 207.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|