C13H18BrN3O3S2 — CID 154012813
N-[2-(2-aminoethyldisulfanyl)ethyl]-3-(3-bromo-4-hydroxyphenyl)-2-hydroxyiminopropanamide (PubChem CID 154012813) has the molecular formula C13H18BrN3O3S2 and a molecular weight of 408.34 g/mol. Its IUPAC name is N-[2-(2-aminoethyldisulfanyl)ethyl]-3-(3-bromo-4-hydroxyphenyl)-2-hydroxyiminopropanamide.
| Compound Name | N-[2-(2-aminoethyldisulfanyl)ethyl]-3-(3-bromo-4-hydroxyphenyl)-2-hydroxyiminopropanamide |
|---|---|
| PubChem CID | 154012813 |
| Molecular Formula | C13H18BrN3O3S2 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 407.00 |
| IUPAC Name | N-[2-(2-aminoethyldisulfanyl)ethyl]-3-(3-bromo-4-hydroxyphenyl)-2-hydroxyiminopropanamide |
| SMILES | NCCSSCCNC(=O)C(Cc1ccc(O)c(Br)c1)=NO |
| InChI | InChI=1S/C13H18BrN3O3S2/c14-10-7-9(1-2-12(10)18)8-11(17-20)13(19)16-4-6-22-21-5-3-15/h1-2,7,18,20H,3-6,8,15H2,(H,16,19) |
| InChIKey | VWQNETDVHGCSJB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|