C10H10BrNO4 — CID 71300222
methyl 3-(3-bromo-4-hydroxyphenyl)-2-hydroxyiminopropanoate (PubChem CID 71300222) has the molecular formula C10H10BrNO4 and a molecular weight of 288.10 g/mol. Its IUPAC name is methyl 3-(3-bromo-4-hydroxyphenyl)-2-hydroxyiminopropanoate.
| Compound Name | methyl 3-(3-bromo-4-hydroxyphenyl)-2-hydroxyiminopropanoate |
|---|---|
| PubChem CID | 71300222 |
| Molecular Formula | C10H10BrNO4 |
| Molecular Weight | 288.10 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | methyl 3-(3-bromo-4-hydroxyphenyl)-2-hydroxyiminopropanoate |
| SMILES | COC(=O)C(Cc1ccc(O)c(Br)c1)=NO |
| InChI | InChI=1S/C10H10BrNO4/c1-16-10(14)8(12-15)5-6-2-3-9(13)7(11)4-6/h2-4,13,15H,5H2,1H3 |
| InChIKey | AMXHNFGHJPBXSJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.10 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|