C17H17ClN2O4S2 — CID 10894917
(2E)-3-(3-chloro-4-hydroxyphenyl)-2-hydroxyimino-N-[2-[(4-hydroxyphenyl)disulfanyl]ethyl]propanamide (PubChem CID 10894917) has the molecular formula C17H17ClN2O4S2 and a molecular weight of 412.92 g/mol. Its IUPAC name is (2E)-3-(3-chloro-4-hydroxyphenyl)-2-hydroxyimino-N-[2-[(4-hydroxyphenyl)disulfanyl]ethyl]propanamide.
| Compound Name | (2E)-3-(3-chloro-4-hydroxyphenyl)-2-hydroxyimino-N-[2-[(4-hydroxyphenyl)disulfanyl]ethyl]propanamide |
|---|---|
| PubChem CID | 10894917 |
| Molecular Formula | C17H17ClN2O4S2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | (2E)-3-(3-chloro-4-hydroxyphenyl)-2-hydroxyimino-N-[2-[(4-hydroxyphenyl)disulfanyl]ethyl]propanamide |
| SMILES | O=C(NCCSSc1ccc(O)cc1)/C(Cc1ccc(O)c(Cl)c1)=N/O |
| InChI | InChI=1S/C17H17ClN2O4S2/c18-14-9-11(1-6-16(14)22)10-15(20-24)17(23)19-7-8-25-26-13-4-2-12(21)3-5-13/h1-6,9,21-22,24H,7-8,10H2,(H,19,23)/b20-15+ |
| InChIKey | JRQWFLPBRDAADC-HMMYKYKNSA-N |
| XLogP | 3.68 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|