C26H34N4O6S2 — CID 142722655
2-methoxyimino-N-[2-[2-[[2-methoxyimino-3-(4-methoxyphenyl)propanoyl]amino]ethyldisulfanyl]ethyl]-3-(4-methoxyphenyl)propanamide (PubChem CID 142722655) has the molecular formula C26H34N4O6S2 and a molecular weight of 562.71 g/mol. Its IUPAC name is 2-methoxyimino-N-[2-[2-[[2-methoxyimino-3-(4-methoxyphenyl)propanoyl]amino]ethyldisulfanyl]ethyl]-3-(4-methoxyphenyl)propanamide.
| Compound Name | 2-methoxyimino-N-[2-[2-[[2-methoxyimino-3-(4-methoxyphenyl)propanoyl]amino]ethyldisulfanyl]ethyl]-3-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 142722655 |
| Molecular Formula | C26H34N4O6S2 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | 2-methoxyimino-N-[2-[2-[[2-methoxyimino-3-(4-methoxyphenyl)propanoyl]amino]ethyldisulfanyl]ethyl]-3-(4-methoxyphenyl)propanamide |
| SMILES | CON=C(Cc1ccc(OC)cc1)C(=O)NCCSSCCNC(=O)C(Cc1ccc(OC)cc1)=NOC |
| InChI | InChI=1S/C26H34N4O6S2/c1-33-21-9-5-19(6-10-21)17-23(29-35-3)25(31)27-13-15-37-38-16-14-28-26(32)24(30-36-4)18-20-7-11-22(34-2)12-8-20/h5-12H,13-18H2,1-4H3,(H,27,31)(H,28,32) |
| InChIKey | ZXFNSQGLGLFYPX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|