C26H34N4O4S2 — CID 155513547
(2E)-2-methoxyimino-N-[2-[2-[[(2E)-2-methoxyimino-3-(4-methylphenyl)propanoyl]amino]ethyldisulfanyl]ethyl]-3-(4-methylphenyl)propanamide (PubChem CID 155513547) has the molecular formula C26H34N4O4S2 and a molecular weight of 530.72 g/mol. Its IUPAC name is (2E)-2-methoxyimino-N-[2-[2-[[(2E)-2-methoxyimino-3-(4-methylphenyl)propanoyl]amino]ethyldisulfanyl]ethyl]-3-(4-methylphenyl)propanamide.
| Compound Name | (2E)-2-methoxyimino-N-[2-[2-[[(2E)-2-methoxyimino-3-(4-methylphenyl)propanoyl]amino]ethyldisulfanyl]ethyl]-3-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 155513547 |
| Molecular Formula | C26H34N4O4S2 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | (2E)-2-methoxyimino-N-[2-[2-[[(2E)-2-methoxyimino-3-(4-methylphenyl)propanoyl]amino]ethyldisulfanyl]ethyl]-3-(4-methylphenyl)propanamide |
| SMILES | CO/N=C(\Cc1ccc(C)cc1)C(=O)NCCSSCCNC(=O)/C(Cc1ccc(C)cc1)=N/OC |
| InChI | InChI=1S/C26H34N4O4S2/c1-19-5-9-21(10-6-19)17-23(29-33-3)25(31)27-13-15-35-36-16-14-28-26(32)24(30-34-4)18-22-11-7-20(2)8-12-22/h5-12H,13-18H2,1-4H3,(H,27,31)(H,28,32)/b29-23+,30-24+ |
| InChIKey | QDQGEQUJVFWAPM-HCTXVGCHSA-N |
| XLogP | 3.71 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|