C17H19N3O2S2 — CID 10872135
(2E)-N-[2-[(4-aminophenyl)disulfanyl]ethyl]-2-hydroxyimino-3-phenylpropanamide (PubChem CID 10872135) has the molecular formula C17H19N3O2S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is (2E)-N-[2-[(4-aminophenyl)disulfanyl]ethyl]-2-hydroxyimino-3-phenylpropanamide.
| Compound Name | (2E)-N-[2-[(4-aminophenyl)disulfanyl]ethyl]-2-hydroxyimino-3-phenylpropanamide |
|---|---|
| PubChem CID | 10872135 |
| Molecular Formula | C17H19N3O2S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (2E)-N-[2-[(4-aminophenyl)disulfanyl]ethyl]-2-hydroxyimino-3-phenylpropanamide |
| SMILES | Nc1ccc(SSCCNC(=O)/C(Cc2ccccc2)=N/O)cc1 |
| InChI | InChI=1S/C17H19N3O2S2/c18-14-6-8-15(9-7-14)24-23-11-10-19-17(21)16(20-22)12-13-4-2-1-3-5-13/h1-9,22H,10-12,18H2,(H,19,21)/b20-16+ |
| InChIKey | DGIXHEQTKVGVPA-CAPFRKAQSA-N |
| XLogP | 3.20 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|