C20H23Br2N3O3 — CID 85154864
N-[3-[4-(2-aminoethyl)-2,6-dibromophenoxy]propyl]-2-hydroxyimino-3-phenylpropanamide (PubChem CID 85154864) has the molecular formula C20H23Br2N3O3 and a molecular weight of 513.23 g/mol. Its IUPAC name is N-[3-[4-(2-aminoethyl)-2,6-dibromophenoxy]propyl]-2-hydroxyimino-3-phenylpropanamide.
| Compound Name | N-[3-[4-(2-aminoethyl)-2,6-dibromophenoxy]propyl]-2-hydroxyimino-3-phenylpropanamide |
|---|---|
| PubChem CID | 85154864 |
| Molecular Formula | C20H23Br2N3O3 |
| Molecular Weight | 513.23 g/mol |
| Exact Mass | 511.01 |
| IUPAC Name | N-[3-[4-(2-aminoethyl)-2,6-dibromophenoxy]propyl]-2-hydroxyimino-3-phenylpropanamide |
| SMILES | NCCc1cc(Br)c(OCCCNC(=O)C(Cc2ccccc2)=NO)c(Br)c1 |
| InChI | InChI=1S/C20H23Br2N3O3/c21-16-11-15(7-8-23)12-17(22)19(16)28-10-4-9-24-20(26)18(25-27)13-14-5-2-1-3-6-14/h1-3,5-6,11-12,27H,4,7-10,13,23H2,(H,24,26) |
| InChIKey | CXPVQEQTURRMQC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.23 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|