C20H30Br2N6O3+2 — CID 23427399
3-[4-[3-[2-(2-amino-1H-imidazol-3-ium-5-yl)ethylamino]-2-hydroxyimino-3-oxopropyl]-2,6-dibromophenoxy]propyl-trimethylazanium (PubChem CID 23427399) has the molecular formula C20H30Br2N6O3+2 and a molecular weight of 562.31 g/mol. Its IUPAC name is 3-[4-[3-[2-(2-amino-1H-imidazol-3-ium-5-yl)ethylamino]-2-hydroxyimino-3-oxopropyl]-2,6-dibromophenoxy]propyl-trimethylazanium.
| Compound Name | 3-[4-[3-[2-(2-amino-1H-imidazol-3-ium-5-yl)ethylamino]-2-hydroxyimino-3-oxopropyl]-2,6-dibromophenoxy]propyl-trimethylazanium |
|---|---|
| PubChem CID | 23427399 |
| Molecular Formula | C20H30Br2N6O3+2 |
| Molecular Weight | 562.31 g/mol |
| Exact Mass | 560.07 |
| IUPAC Name | 3-[4-[3-[2-(2-amino-1H-imidazol-3-ium-5-yl)ethylamino]-2-hydroxyimino-3-oxopropyl]-2,6-dibromophenoxy]propyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCOc1c(Br)cc(CC(=NO)C(=O)NCCc2c[nH+]c(N)[nH]2)cc1Br |
| InChI | InChI=1S/C20H28Br2N6O3/c1-28(2,3)7-4-8-31-18-15(21)9-13(10-16(18)22)11-17(27-30)19(29)24-6-5-14-12-25-20(23)26-14/h9-10,12H,4-8,11H2,1-3H3,(H4-,23,24,25,26,27,29,30)/p+2 |
| InChIKey | GESWTAZPAHIWME-UHFFFAOYSA-P |
| XLogP | 2.14 |
| TPSA | 126.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|