C20H23Br2Cl2N3O3 — CID 11635621
(2E)-3-[4-(3-aminopropoxy)-3,5-dibromophenyl]-N-[2-(4-chlorophenyl)ethyl]-2-hydroxyiminopropanamide;hydrochloride (PubChem CID 11635621) has the molecular formula C20H23Br2Cl2N3O3 and a molecular weight of 584.14 g/mol. Its IUPAC name is (2E)-3-[4-(3-aminopropoxy)-3,5-dibromophenyl]-N-[2-(4-chlorophenyl)ethyl]-2-hydroxyiminopropanamide;hydrochloride.
| Compound Name | (2E)-3-[4-(3-aminopropoxy)-3,5-dibromophenyl]-N-[2-(4-chlorophenyl)ethyl]-2-hydroxyiminopropanamide;hydrochloride |
|---|---|
| PubChem CID | 11635621 |
| Molecular Formula | C20H23Br2Cl2N3O3 |
| Molecular Weight | 584.14 g/mol |
| Exact Mass | 580.95 |
| IUPAC Name | (2E)-3-[4-(3-aminopropoxy)-3,5-dibromophenyl]-N-[2-(4-chlorophenyl)ethyl]-2-hydroxyiminopropanamide;hydrochloride |
| SMILES | Cl.NCCCOc1c(Br)cc(C/C(=N\O)C(=O)NCCc2ccc(Cl)cc2)cc1Br |
| InChI | InChI=1S/C20H22Br2ClN3O3.ClH/c21-16-10-14(11-17(22)19(16)29-9-1-7-24)12-18(26-28)20(27)25-8-6-13-2-4-15(23)5-3-13;/h2-5,10-11,28H,1,6-9,12,24H2,(H,25,27);1H/b26-18+; |
| InChIKey | QTPLGBXYEGCSQU-DEGQLRSHSA-N |
| XLogP | 4.75 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.14 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|