C22H25Br4N3O4 — CID 127039321
(2E)-3-(3,5-dibromo-4-methoxyphenyl)-N-[2-[3,5-dibromo-4-[3-(methylamino)propoxy]phenyl]ethyl]-2-hydroxyiminopropanamide (PubChem CID 127039321) has the molecular formula C22H25Br4N3O4 and a molecular weight of 715.07 g/mol. Its IUPAC name is (2E)-3-(3,5-dibromo-4-methoxyphenyl)-N-[2-[3,5-dibromo-4-[3-(methylamino)propoxy]phenyl]ethyl]-2-hydroxyiminopropanamide.
| Compound Name | (2E)-3-(3,5-dibromo-4-methoxyphenyl)-N-[2-[3,5-dibromo-4-[3-(methylamino)propoxy]phenyl]ethyl]-2-hydroxyiminopropanamide |
|---|---|
| PubChem CID | 127039321 |
| Molecular Formula | C22H25Br4N3O4 |
| Molecular Weight | 715.07 g/mol |
| Exact Mass | 710.86 |
| IUPAC Name | (2E)-3-(3,5-dibromo-4-methoxyphenyl)-N-[2-[3,5-dibromo-4-[3-(methylamino)propoxy]phenyl]ethyl]-2-hydroxyiminopropanamide |
| SMILES | CNCCCOc1c(Br)cc(CCNC(=O)/C(Cc2cc(Br)c(OC)c(Br)c2)=N/O)cc1Br |
| InChI | InChI=1S/C22H25Br4N3O4/c1-27-5-3-7-33-21-17(25)8-13(9-18(21)26)4-6-28-22(30)19(29-31)12-14-10-15(23)20(32-2)16(24)11-14/h8-11,27,31H,3-7,12H2,1-2H3,(H,28,30)/b29-19+ |
| InChIKey | GTDUPJAILGQJRR-VUTHCHCSSA-N |
| XLogP | 5.47 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.07 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|