C23H32Br2F6N8O7 — CID 10101897
(2E)-N-[4-(diaminomethylideneamino)butyl]-3-[3,5-dibromo-4-[4-(diaminomethylideneamino)butoxy]phenyl]-2-hydroxyiminopropanamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 10101897) has the molecular formula C23H32Br2F6N8O7 and a molecular weight of 806.35 g/mol. Its IUPAC name is (2E)-N-[4-(diaminomethylideneamino)butyl]-3-[3,5-dibromo-4-[4-(diaminomethylideneamino)butoxy]phenyl]-2-hydroxyiminopropanamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (2E)-N-[4-(diaminomethylideneamino)butyl]-3-[3,5-dibromo-4-[4-(diaminomethylideneamino)butoxy]phenyl]-2-hydroxyiminopropanamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 10101897 |
| Molecular Formula | C23H32Br2F6N8O7 |
| Molecular Weight | 806.35 g/mol |
| Exact Mass | 804.07 |
| IUPAC Name | (2E)-N-[4-(diaminomethylideneamino)butyl]-3-[3,5-dibromo-4-[4-(diaminomethylideneamino)butoxy]phenyl]-2-hydroxyiminopropanamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NC(N)=NCCCCNC(=O)/C(Cc1cc(Br)c(OCCCCN=C(N)N)c(Br)c1)=N/O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H30Br2N8O3.2C2HF3O2/c20-13-9-12(10-14(21)16(13)32-8-4-3-7-28-19(24)25)11-15(29-31)17(30)26-5-1-2-6-27-18(22)23;2*3-2(4,5)1(6)7/h9-10,31H,1-8,11H2,(H,26,30)(H4,22,23,27)(H4,24,25,28);2*(H,6,7)/b29-15+;; |
| InChIKey | IJAWQNWNDLDPIJ-PZBXTSNBSA-N |
| XLogP | 2.45 |
| TPSA | 274.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|