C17H29N7O3 — CID 142819331
(2Z)-3-[4-(3-aminopropoxy)phenyl]-N-[4-(diaminomethylideneamino)butyl]-2-(hydroxyhydrazinylidene)propanamide (PubChem CID 142819331) has the molecular formula C17H29N7O3 and a molecular weight of 379.47 g/mol. Its IUPAC name is (2Z)-3-[4-(3-aminopropoxy)phenyl]-N-[4-(diaminomethylideneamino)butyl]-2-(hydroxyhydrazinylidene)propanamide.
| Compound Name | (2Z)-3-[4-(3-aminopropoxy)phenyl]-N-[4-(diaminomethylideneamino)butyl]-2-(hydroxyhydrazinylidene)propanamide |
|---|---|
| PubChem CID | 142819331 |
| Molecular Formula | C17H29N7O3 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | (2Z)-3-[4-(3-aminopropoxy)phenyl]-N-[4-(diaminomethylideneamino)butyl]-2-(hydroxyhydrazinylidene)propanamide |
| SMILES | NCCCOc1ccc(C/C(=N/NO)C(=O)NCCCCN=C(N)N)cc1 |
| InChI | InChI=1S/C17H29N7O3/c18-8-3-11-27-14-6-4-13(5-7-14)12-15(23-24-26)16(25)21-9-1-2-10-22-17(19)20/h4-7,24,26H,1-3,8-12,18H2,(H,21,25)(H4,19,20,22)/b23-15- |
| InChIKey | RNGIGWFQVOFRMQ-HAHDFKILSA-N |
| XLogP | -0.54 |
| TPSA | 173.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|