C13H21ClN4O2 — CID 174646948
N-[4-(diaminomethylideneamino)butyl]-4-methoxybenzamide;hydrochloride (PubChem CID 174646948) has the molecular formula C13H21ClN4O2 and a molecular weight of 300.79 g/mol. Its IUPAC name is N-[4-(diaminomethylideneamino)butyl]-4-methoxybenzamide;hydrochloride.
| Compound Name | N-[4-(diaminomethylideneamino)butyl]-4-methoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 174646948 |
| Molecular Formula | C13H21ClN4O2 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-[4-(diaminomethylideneamino)butyl]-4-methoxybenzamide;hydrochloride |
| SMILES | COc1ccc(C(=O)NCCCCN=C(N)N)cc1.Cl |
| InChI | InChI=1S/C13H20N4O2.ClH/c1-19-11-6-4-10(5-7-11)12(18)16-8-2-3-9-17-13(14)15;/h4-7H,2-3,8-9H2,1H3,(H,16,18)(H4,14,15,17);1H |
| InChIKey | OHJYZWBLPNVJLK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|