C18H28N4O3 — CID 175335295
3-cyclopentyloxy-N-[4-(diaminomethylideneamino)butyl]-4-methoxybenzamide (PubChem CID 175335295) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 3-cyclopentyloxy-N-[4-(diaminomethylideneamino)butyl]-4-methoxybenzamide.
| Compound Name | 3-cyclopentyloxy-N-[4-(diaminomethylideneamino)butyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 175335295 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 3-cyclopentyloxy-N-[4-(diaminomethylideneamino)butyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCCCN=C(N)N)cc1OC1CCCC1 |
| InChI | InChI=1S/C18H28N4O3/c1-24-15-9-8-13(12-16(15)25-14-6-2-3-7-14)17(23)21-10-4-5-11-22-18(19)20/h8-9,12,14H,2-7,10-11H2,1H3,(H,21,23)(H4,19,20,22) |
| InChIKey | LELLOWWODOKJGZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|