C19H31ClN8O3 — CID 85105472
3-[3-chloro-4-[4-(diaminomethylideneamino)butoxy]phenyl]-N-[4-(diaminomethylideneamino)butyl]-2-hydroxyiminopropanamide (PubChem CID 85105472) has the molecular formula C19H31ClN8O3 and a molecular weight of 454.96 g/mol. Its IUPAC name is 3-[3-chloro-4-[4-(diaminomethylideneamino)butoxy]phenyl]-N-[4-(diaminomethylideneamino)butyl]-2-hydroxyiminopropanamide.
| Compound Name | 3-[3-chloro-4-[4-(diaminomethylideneamino)butoxy]phenyl]-N-[4-(diaminomethylideneamino)butyl]-2-hydroxyiminopropanamide |
|---|---|
| PubChem CID | 85105472 |
| Molecular Formula | C19H31ClN8O3 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 3-[3-chloro-4-[4-(diaminomethylideneamino)butoxy]phenyl]-N-[4-(diaminomethylideneamino)butyl]-2-hydroxyiminopropanamide |
| SMILES | NC(N)=NCCCCNC(=O)C(Cc1ccc(OCCCCN=C(N)N)c(Cl)c1)=NO |
| InChI | InChI=1S/C19H31ClN8O3/c20-14-11-13(5-6-16(14)31-10-4-3-9-27-19(23)24)12-15(28-30)17(29)25-7-1-2-8-26-18(21)22/h5-6,11,30H,1-4,7-10,12H2,(H,25,29)(H4,21,22,26)(H4,23,24,27) |
| InChIKey | BONBPRMFZYARML-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 199.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|