C10H14ClN3OS — CID 144552133
2-[[3-chloro-4-(2-sulfanylethoxy)phenyl]methyl]guanidine (PubChem CID 144552133) has the molecular formula C10H14ClN3OS and a molecular weight of 259.76 g/mol. Its IUPAC name is 2-[[3-chloro-4-(2-sulfanylethoxy)phenyl]methyl]guanidine.
| Compound Name | 2-[[3-chloro-4-(2-sulfanylethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 144552133 |
| Molecular Formula | C10H14ClN3OS |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-[[3-chloro-4-(2-sulfanylethoxy)phenyl]methyl]guanidine |
| SMILES | NC(N)=NCc1ccc(OCCS)c(Cl)c1 |
| InChI | InChI=1S/C10H14ClN3OS/c11-8-5-7(6-14-10(12)13)1-2-9(8)15-3-4-16/h1-2,5,16H,3-4,6H2,(H4,12,13,14) |
| InChIKey | XFDRWVPZGUOOQJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|