C10H13FIN3O — CID 71510557
2-[[4-(2-fluoroethoxy)-3-iodophenyl]methyl]guanidine (PubChem CID 71510557) has the molecular formula C10H13FIN3O and a molecular weight of 337.14 g/mol. Its IUPAC name is 2-[[4-(2-fluoroethoxy)-3-iodophenyl]methyl]guanidine.
| Compound Name | 2-[[4-(2-fluoroethoxy)-3-iodophenyl]methyl]guanidine |
|---|---|
| PubChem CID | 71510557 |
| Molecular Formula | C10H13FIN3O |
| Molecular Weight | 337.14 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 2-[[4-(2-fluoroethoxy)-3-iodophenyl]methyl]guanidine |
| SMILES | NC(N)=NCc1ccc(OCCF)c(I)c1 |
| InChI | InChI=1S/C10H13FIN3O/c11-3-4-16-9-2-1-7(5-8(9)12)6-15-10(13)14/h1-2,5H,3-4,6H2,(H4,13,14,15) |
| InChIKey | OADSOTDSPRCXGK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.14 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|