C11H15BrFN3O — CID 24989762
2-[[3-bromo-4-(3-(18F)fluoropropoxy)phenyl]methyl]guanidine (PubChem CID 24989762) has the molecular formula C11H15BrFN3O and a molecular weight of 303.17 g/mol. Its IUPAC name is 2-[[3-bromo-4-(3-(18F)fluoropropoxy)phenyl]methyl]guanidine.
| Compound Name | 2-[[3-bromo-4-(3-(18F)fluoropropoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 24989762 |
| Molecular Formula | C11H15BrFN3O |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 2-[[3-bromo-4-(3-(18F)fluoropropoxy)phenyl]methyl]guanidine |
| SMILES | NC(N)=NCc1ccc(OCCC[18F])c(Br)c1 |
| InChI | InChI=1S/C11H15BrFN3O/c12-9-6-8(7-16-11(14)15)2-3-10(9)17-5-1-4-13/h2-3,6H,1,4-5,7H2,(H4,14,15,16)/i13-1 |
| InChIKey | ZYULQCDNUYJBRI-HSGWXFLFSA-N |
| XLogP | 1.96 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|