C19H24Br2N6O2 — CID 44531372
2-[3-bromo-4-[5-[2-bromo-4-(diaminomethylideneamino)phenoxy]pentoxy]phenyl]guanidine (PubChem CID 44531372) has the molecular formula C19H24Br2N6O2 and a molecular weight of 528.25 g/mol. Its IUPAC name is 2-[3-bromo-4-[5-[2-bromo-4-(diaminomethylideneamino)phenoxy]pentoxy]phenyl]guanidine.
| Compound Name | 2-[3-bromo-4-[5-[2-bromo-4-(diaminomethylideneamino)phenoxy]pentoxy]phenyl]guanidine |
|---|---|
| PubChem CID | 44531372 |
| Molecular Formula | C19H24Br2N6O2 |
| Molecular Weight | 528.25 g/mol |
| Exact Mass | 526.03 |
| IUPAC Name | 2-[3-bromo-4-[5-[2-bromo-4-(diaminomethylideneamino)phenoxy]pentoxy]phenyl]guanidine |
| SMILES | NC(N)=Nc1ccc(OCCCCCOc2ccc(N=C(N)N)cc2Br)c(Br)c1 |
| InChI | InChI=1S/C19H24Br2N6O2/c20-14-10-12(26-18(22)23)4-6-16(14)28-8-2-1-3-9-29-17-7-5-13(11-15(17)21)27-19(24)25/h4-7,10-11H,1-3,8-9H2,(H4,22,23,26)(H4,24,25,27) |
| InChIKey | MZRFOHQJXYFJAH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 147.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|