C11H15BrFN3OS — CID 138502564
3-[2-bromo-4-[(diaminomethylideneamino)methyl]phenoxy]propyl thiohypofluorite (PubChem CID 138502564) has the molecular formula C11H15BrFN3OS and a molecular weight of 336.23 g/mol. Its IUPAC name is 3-[2-bromo-4-[(diaminomethylideneamino)methyl]phenoxy]propyl thiohypofluorite.
| Compound Name | 3-[2-bromo-4-[(diaminomethylideneamino)methyl]phenoxy]propyl thiohypofluorite |
|---|---|
| PubChem CID | 138502564 |
| Molecular Formula | C11H15BrFN3OS |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 3-[2-bromo-4-[(diaminomethylideneamino)methyl]phenoxy]propyl thiohypofluorite |
| SMILES | NC(N)=NCc1ccc(OCCCSF)c(Br)c1 |
| InChI | InChI=1S/C11H15BrFN3OS/c12-9-6-8(7-16-11(14)15)2-3-10(9)17-4-1-5-18-13/h2-3,6H,1,4-5,7H2,(H4,14,15,16) |
| InChIKey | CJKNOOVYTIWJNJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|