C11H15BrIN3O4S — CID 146615447
2-bromo-4-[(diaminomethylideneamino)methyl]-1-(3-iodosulfonyloxypropoxy)benzene (PubChem CID 146615447) has the molecular formula C11H15BrIN3O4S and a molecular weight of 492.13 g/mol. Its IUPAC name is 2-bromo-4-[(diaminomethylideneamino)methyl]-1-(3-iodosulfonyloxypropoxy)benzene.
| Compound Name | 2-bromo-4-[(diaminomethylideneamino)methyl]-1-(3-iodosulfonyloxypropoxy)benzene |
|---|---|
| PubChem CID | 146615447 |
| Molecular Formula | C11H15BrIN3O4S |
| Molecular Weight | 492.13 g/mol |
| Exact Mass | 490.90 |
| IUPAC Name | 2-bromo-4-[(diaminomethylideneamino)methyl]-1-(3-iodosulfonyloxypropoxy)benzene |
| SMILES | NC(N)=NCc1ccc(OCCCOS(=O)(=O)I)c(Br)c1 |
| InChI | InChI=1S/C11H15BrIN3O4S/c12-9-6-8(7-16-11(14)15)2-3-10(9)19-4-1-5-20-21(13,17)18/h2-3,6H,1,4-5,7H2,(H4,14,15,16) |
| InChIKey | IZDJJGZFSFVBPE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.13 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|