C12H16BrFN2O — CID 59470535
N'-[[3-bromo-4-(3-(18F)fluoropropoxy)phenyl]methyl]ethanimidamide (PubChem CID 59470535) has the molecular formula C12H16BrFN2O and a molecular weight of 302.18 g/mol. Its IUPAC name is N'-[[3-bromo-4-(3-(18F)fluoropropoxy)phenyl]methyl]ethanimidamide.
| Compound Name | N'-[[3-bromo-4-(3-(18F)fluoropropoxy)phenyl]methyl]ethanimidamide |
|---|---|
| PubChem CID | 59470535 |
| Molecular Formula | C12H16BrFN2O |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N'-[[3-bromo-4-(3-(18F)fluoropropoxy)phenyl]methyl]ethanimidamide |
| SMILES | C/C(N)=N\Cc1ccc(OCCC[18F])c(Br)c1 |
| InChI | InChI=1S/C12H16BrFN2O/c1-9(15)16-8-10-3-4-12(11(13)7-10)17-6-2-5-14/h3-4,7H,2,5-6,8H2,1H3,(H2,15,16)/i14-1 |
| InChIKey | KTQFUSXUDMWPJH-UMSOTBISSA-N |
| XLogP | 3.06 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|