C18H23Br2N3O7S2 — CID 175167019
3-[2-bromo-4-[(diaminomethylideneamino)methyl]phenoxy]propyl 4-bromobenzenesulfonate;methanesulfonic acid (PubChem CID 175167019) has the molecular formula C18H23Br2N3O7S2 and a molecular weight of 617.34 g/mol. Its IUPAC name is 3-[2-bromo-4-[(diaminomethylideneamino)methyl]phenoxy]propyl 4-bromobenzenesulfonate;methanesulfonic acid.
| Compound Name | 3-[2-bromo-4-[(diaminomethylideneamino)methyl]phenoxy]propyl 4-bromobenzenesulfonate;methanesulfonic acid |
|---|---|
| PubChem CID | 175167019 |
| Molecular Formula | C18H23Br2N3O7S2 |
| Molecular Weight | 617.34 g/mol |
| Exact Mass | 614.93 |
| IUPAC Name | 3-[2-bromo-4-[(diaminomethylideneamino)methyl]phenoxy]propyl 4-bromobenzenesulfonate;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.NC(N)=NCc1ccc(OCCCOS(=O)(=O)c2ccc(Br)cc2)c(Br)c1 |
| InChI | InChI=1S/C17H19Br2N3O4S.CH4O3S/c18-13-3-5-14(6-4-13)27(23,24)26-9-1-8-25-16-7-2-12(10-15(16)19)11-22-17(20)21;1-5(2,3)4/h2-7,10H,1,8-9,11H2,(H4,20,21,22);1H3,(H,2,3,4) |
| InChIKey | ZUVKMZMVIVGVFL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 171.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|