C14H16FN3OS — CID 138502735
2-[6-[(diaminomethylideneamino)methyl]naphthalen-2-yl]oxyethyl thiohypofluorite (PubChem CID 138502735) has the molecular formula C14H16FN3OS and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-[6-[(diaminomethylideneamino)methyl]naphthalen-2-yl]oxyethyl thiohypofluorite.
| Compound Name | 2-[6-[(diaminomethylideneamino)methyl]naphthalen-2-yl]oxyethyl thiohypofluorite |
|---|---|
| PubChem CID | 138502735 |
| Molecular Formula | C14H16FN3OS |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-[6-[(diaminomethylideneamino)methyl]naphthalen-2-yl]oxyethyl thiohypofluorite |
| SMILES | NC(N)=NCc1ccc2cc(OCCSF)ccc2c1 |
| InChI | InChI=1S/C14H16FN3OS/c15-20-6-5-19-13-4-3-11-7-10(9-18-14(16)17)1-2-12(11)8-13/h1-4,7-8H,5-6,9H2,(H4,16,17,18) |
| InChIKey | VVAAMXGTGQNWSE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|