C12H15N4O3+ — CID 6331948
dihydroxy(oxo)azanium;2-(naphthalen-2-ylmethyl)guanidine (PubChem CID 6331948) has the molecular formula C12H15N4O3+ and a molecular weight of 263.28 g/mol. Its IUPAC name is dihydroxy(oxo)azanium;2-(naphthalen-2-ylmethyl)guanidine.
| Compound Name | dihydroxy(oxo)azanium;2-(naphthalen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 6331948 |
| Molecular Formula | C12H15N4O3+ |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | dihydroxy(oxo)azanium;2-(naphthalen-2-ylmethyl)guanidine |
| SMILES | NC(N)=NCc1ccc2ccccc2c1.O=[N+](O)O |
| InChI | InChI=1S/C12H13N3.H2NO3/c13-12(14)15-8-9-5-6-10-3-1-2-4-11(10)7-9;2-1(3)4/h1-7H,8H2,(H4,13,14,15);(H2,2,3,4)/q;+1 |
| InChIKey | ZSSOFFBMLIFGAD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|