C16H20IN3 — CID 110029931
1-cyclopropyl-1-methyl-2-(naphthalen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110029931) has the molecular formula C16H20IN3 and a molecular weight of 381.26 g/mol. Its IUPAC name is 1-cyclopropyl-1-methyl-2-(naphthalen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-1-methyl-2-(naphthalen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110029931 |
| Molecular Formula | C16H20IN3 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 1-cyclopropyl-1-methyl-2-(naphthalen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CN(/C(N)=N/Cc1ccc2ccccc2c1)C1CC1.I |
| InChI | InChI=1S/C16H19N3.HI/c1-19(15-8-9-15)16(17)18-11-12-6-7-13-4-2-3-5-14(13)10-12;/h2-7,10,15H,8-9,11H2,1H3,(H2,17,18);1H |
| InChIKey | QQEQIHPKAZYDMR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|