C14H19F3IN3O — CID 110029707
1-cyclopropyl-1-methyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 110029707) has the molecular formula C14H19F3IN3O and a molecular weight of 429.22 g/mol. Its IUPAC name is 1-cyclopropyl-1-methyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-1-methyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110029707 |
| Molecular Formula | C14H19F3IN3O |
| Molecular Weight | 429.22 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 1-cyclopropyl-1-methyl-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CN(/C(N)=N/Cc1ccc(OCC(F)(F)F)cc1)C1CC1.I |
| InChI | InChI=1S/C14H18F3N3O.HI/c1-20(11-4-5-11)13(18)19-8-10-2-6-12(7-3-10)21-9-14(15,16)17;/h2-3,6-7,11H,4-5,8-9H2,1H3,(H2,18,19);1H |
| InChIKey | TWYRPLRGIXGSAY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.22 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|