C15H21N3O2 — CID 110030507
ethyl 4-[[[amino-[cyclopropyl(methyl)amino]methylidene]amino]methyl]benzoate (PubChem CID 110030507) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is ethyl 4-[[[amino-[cyclopropyl(methyl)amino]methylidene]amino]methyl]benzoate.
| Compound Name | ethyl 4-[[[amino-[cyclopropyl(methyl)amino]methylidene]amino]methyl]benzoate |
|---|---|
| PubChem CID | 110030507 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | ethyl 4-[[[amino-[cyclopropyl(methyl)amino]methylidene]amino]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C/N=C(\N)N(C)C2CC2)cc1 |
| InChI | InChI=1S/C15H21N3O2/c1-3-20-14(19)12-6-4-11(5-7-12)10-17-15(16)18(2)13-8-9-13/h4-7,13H,3,8-10H2,1-2H3,(H2,16,17) |
| InChIKey | SCGWPYAYGQKHGF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|