About ethyl 4-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]benzoate;hydroiodide
ethyl 4-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]benzoate;hydroiodide (PubChem CID 109383415) has the molecular formula C19H30IN3O3
and a molecular weight of 475.37 g/mol. Its IUPAC name is ethyl 4-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]benzoate;hydroiodide.
Molecular Properties
| Compound Name | ethyl 4-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]benzoate;hydroiodide |
| PubChem CID | 109383415 |
| Molecular Formula | C19H30IN3O3 |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | ethyl 4-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]benzoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)OCC)cc1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C19H29N3O3.HI/c1-4-20-19(22(3)13-16-10-11-24-14-16)21-12-15-6-8-17(9-7-15)18(23)25-5-2;/h6-9,16H,4-5,10-14H2,1-3H3,(H,20,21);1H |
| InChIKey | FKPKWQSADKUTEJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]benzoate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]benzoate;hydroiodide?
The IUPAC name of ethyl 4-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]benzoate;hydroiodide (CID 109383415) is ethyl 4-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]benzoate;hydroiodide.
What is the SMILES notation for ethyl 4-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]benzoate;hydroiodide?
The canonical SMILES for ethyl 4-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]benzoate;hydroiodide is CCN/C(=N\Cc1ccc(C(=O)OCC)cc1)N(C)CC1CCOC1.I.
What is the InChIKey of ethyl 4-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]benzoate;hydroiodide?
The InChIKey is FKPKWQSADKUTEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29N3O3.HI/c1-4-20-19(22(3)13-16-10-11-24-14-16)21-12-15-6-8-17(9-7-15)18(23)25-5-2;/h6-9,16H,4-5,10-14H2,1-3H3,(H,20,21);1H.
What are the key properties of ethyl 4-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]benzoate;hydroiodide?
ethyl 4-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]benzoate;hydroiodide has a molecular weight of 475.37 g/mol, XLogP of 2.92, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]benzoate;hydroiodide is sourced from PubChem (CID 109383415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).