C24H31N3O3 — CID 109386839
benzyl 3-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]benzoate (PubChem CID 109386839) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is benzyl 3-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]benzoate.
| Compound Name | benzyl 3-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]benzoate |
|---|---|
| PubChem CID | 109386839 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | benzyl 3-[[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]methyl]benzoate |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)OCc2ccccc2)c1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C24H31N3O3/c1-3-25-24(27(2)16-21-12-13-29-17-21)26-15-20-10-7-11-22(14-20)23(28)30-18-19-8-5-4-6-9-19/h4-11,14,21H,3,12-13,15-18H2,1-2H3,(H,25,26) |
| InChIKey | MFKRULJNQMGBPO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|