C11H17Cl2N5O — CID 11957305
2-[(3-chloro-4-ethoxyphenyl)methyl]-1-(diaminomethylidene)guanidine;hydrochloride (PubChem CID 11957305) has the molecular formula C11H17Cl2N5O and a molecular weight of 306.20 g/mol. Its IUPAC name is 2-[(3-chloro-4-ethoxyphenyl)methyl]-1-(diaminomethylidene)guanidine;hydrochloride.
| Compound Name | 2-[(3-chloro-4-ethoxyphenyl)methyl]-1-(diaminomethylidene)guanidine;hydrochloride |
|---|---|
| PubChem CID | 11957305 |
| Molecular Formula | C11H17Cl2N5O |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-[(3-chloro-4-ethoxyphenyl)methyl]-1-(diaminomethylidene)guanidine;hydrochloride |
| SMILES | CCOc1ccc(C/N=C(\N)N=C(N)N)cc1Cl.Cl |
| InChI | InChI=1S/C11H16ClN5O.ClH/c1-2-18-9-4-3-7(5-8(9)12)6-16-11(15)17-10(13)14;/h3-5H,2,6H2,1H3,(H6,13,14,15,16,17);1H |
| InChIKey | WEAYMMLYVVWHLH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|